Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 20880-92-6, Name is ((3aS,5aR,8aR,8bS)-2,2,7,7-Tetramethyltetrahydro-3aH-bis([1,3]dioxolo)[4,5-b:4′,5′-d]pyran-3a-yl)methanol, SMILES is OC[C@@]1([C@H]([C@@H]([C@@H](CO1)O2)OC2(C)C)O3)OC3(C)C, belongs to pyrrolines compound. In a document, author is Bird, James E., introduce the new discover, Safety of ((3aS,5aR,8aR,8bS)-2,2,7,7-Tetramethyltetrahydro-3aH-bis([1,3]dioxolo)[4,5-b:4′,5′-d]pyran-3a-yl)methanol.
Nitrile Oxidation at a Ruthenium Complex leading to Intermolecular Imido Group Transfer
The oxidation of an acetonitrile ligand coordinated to ruthenium is explored in deuterated dimethyl sulfoxide by H-1 NMR spectroscopy. When oxidized with an iodosoarene oxygen atom transfer (OAT) reagent, kinetic studies demonstrate that the nitrile ligand does not dissociate before reacting. Instead, OAT to the central nitrile carbon is implicated (nitrile oxidation) and is further supported by the product of the reaction, N-acyldimethylsulfoximine. The N-acyldimethylsulfoximine likely formed by an imido group transfer reaction from ruthenium to the NMR solvent, and the product was synthesized independently to verify its identity in the reaction. This reaction represents the first time that a nitrile oxidation reaction has resulted in intermolecular imido group transfer to a substrate, presumably through a reactive ruthenium(IV)imido intermediate. This suggests that nitrile oxidation is a plausible route into reactive metal-imido intermediates for amination and aziridination reactions.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 20880-92-6 is helpful to your research. Safety of ((3aS,5aR,8aR,8bS)-2,2,7,7-Tetramethyltetrahydro-3aH-bis([1,3]dioxolo)[4,5-b:4′,5′-d]pyran-3a-yl)methanol.
Reference:
Pyrroline – Wikipedia,
,1-Pyrroline | C4H7N – PubChem